C6H6N6O6 — CID 6455494
4,5,6-trinitrobenzene-1,2,3-triamine (PubChem CID 6455494) has the molecular formula C6H6N6O6 and a molecular weight of 258.15 g/mol. Its IUPAC name is 4,5,6-trinitrobenzene-1,2,3-triamine.
| Compound Name | 4,5,6-trinitrobenzene-1,2,3-triamine |
|---|---|
| PubChem CID | 6455494 |
| Molecular Formula | C6H6N6O6 |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 4,5,6-trinitrobenzene-1,2,3-triamine |
| SMILES | Nc1c(N)c([N+](=O)[O-])c([N+](=O)[O-])c([N+](=O)[O-])c1N |
| InChI | InChI=1S/C6H6N6O6/c7-1-2(8)4(10(13)14)6(12(17)18)5(3(1)9)11(15)16/h7-9H2 |
| InChIKey | MKWKGRNINWTHMC-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 207.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|