C9H7F6N — CID 64555020
3,4,5-trifluoro-N-(3,3,3-trifluoropropyl)aniline (PubChem CID 64555020) has the molecular formula C9H7F6N and a molecular weight of 243.15 g/mol. Its IUPAC name is 3,4,5-trifluoro-N-(3,3,3-trifluoropropyl)aniline.
| Compound Name | 3,4,5-trifluoro-N-(3,3,3-trifluoropropyl)aniline |
|---|---|
| PubChem CID | 64555020 |
| Molecular Formula | C9H7F6N |
| Molecular Weight | 243.15 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 3,4,5-trifluoro-N-(3,3,3-trifluoropropyl)aniline |
| SMILES | Fc1cc(NCCC(F)(F)F)cc(F)c1F |
| InChI | InChI=1S/C9H7F6N/c10-6-3-5(4-7(11)8(6)12)16-2-1-9(13,14)15/h3-4,16H,1-2H2 |
| InChIKey | DGRICUBIVUJJCK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.15 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|