C31H54N4O4 — CID 6455505
3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane;oxepan-2-one (PubChem CID 6455505) has the molecular formula C31H54N4O4 and a molecular weight of 546.80 g/mol. Its IUPAC name is 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane;oxepan-2-one.
| Compound Name | 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane;oxepan-2-one |
|---|---|
| PubChem CID | 6455505 |
| Molecular Formula | C31H54N4O4 |
| Molecular Weight | 546.80 g/mol |
| Exact Mass | 546.41 |
| IUPAC Name | 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane;oxepan-2-one |
| SMILES | CC1(C)CC(N)CC(C)(CN)C1.O=C1CCCCCO1.O=C=NC1CCC(CC2CCC(N=C=O)CC2)CC1 |
| InChI | InChI=1S/C15H22N2O2.C10H22N2.C6H10O2/c18-10-16-14-5-1-12(2-6-14)9-13-3-7-15(8-4-13)17-11-19;1-9(2)4-8(12)5-10(3,6-9)7-11;7-6-4-2-1-3-5-8-6/h12-15H,1-9H2;8H,4-7,11-12H2,1-3H3;1-5H2 |
| InChIKey | JXOUEHYHBZRCQK-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 137.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.80 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|