About diethoxy(dimethyl)silane;triethoxy(phenyl)silane;3-triethoxysilylpropan-1-amine
diethoxy(dimethyl)silane;triethoxy(phenyl)silane;3-triethoxysilylpropan-1-amine (PubChem CID 6455506) has the molecular formula C27H59NO8Si3
and a molecular weight of 610.03 g/mol. Its IUPAC name is diethoxy(dimethyl)silane;triethoxy(phenyl)silane;3-triethoxysilylpropan-1-amine.
Molecular Properties
| Compound Name | diethoxy(dimethyl)silane;triethoxy(phenyl)silane;3-triethoxysilylpropan-1-amine |
| PubChem CID | 6455506 |
| Molecular Formula | C27H59NO8Si3 |
| Molecular Weight | 610.03 g/mol |
| Exact Mass | 609.35 |
| IUPAC Name | diethoxy(dimethyl)silane;triethoxy(phenyl)silane;3-triethoxysilylpropan-1-amine |
| SMILES | CCO[Si](C)(C)OCC.CCO[Si](CCCN)(OCC)OCC.CCO[Si](OCC)(OCC)c1ccccc1 |
| InChI | InChI=1S/C12H20O3Si.C9H23NO3Si.C6H16O2Si/c1-4-13-16(14-5-2,15-6-3)12-10-8-7-9-11-12;1-4-11-14(12-5-2,13-6-3)9-7-8-10;1-5-7-9(3,4)8-6-2/h7-11H,4-6H2,1-3H3;4-10H2,1-3H3;5-6H2,1-4H3 |
| InChIKey | CMKNAQCGCBCKRL-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 610.03 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diethoxy(dimethyl)silane;triethoxy(phenyl)silane;3-triethoxysilylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxy(dimethyl)silane;triethoxy(phenyl)silane;3-triethoxysilylpropan-1-amine?
The IUPAC name of diethoxy(dimethyl)silane;triethoxy(phenyl)silane;3-triethoxysilylpropan-1-amine (CID 6455506) is diethoxy(dimethyl)silane;triethoxy(phenyl)silane;3-triethoxysilylpropan-1-amine.
What is the SMILES notation for diethoxy(dimethyl)silane;triethoxy(phenyl)silane;3-triethoxysilylpropan-1-amine?
The canonical SMILES for diethoxy(dimethyl)silane;triethoxy(phenyl)silane;3-triethoxysilylpropan-1-amine is CCO[Si](C)(C)OCC.CCO[Si](CCCN)(OCC)OCC.CCO[Si](OCC)(OCC)c1ccccc1.
What is the InChIKey of diethoxy(dimethyl)silane;triethoxy(phenyl)silane;3-triethoxysilylpropan-1-amine?
The InChIKey is CMKNAQCGCBCKRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3Si.C9H23NO3Si.C6H16O2Si/c1-4-13-16(14-5-2,15-6-3)12-10-8-7-9-11-12;1-4-11-14(12-5-2,13-6-3)9-7-8-10;1-5-7-9(3,4)8-6-2/h7-11H,4-6H2,1-3H3;4-10H2,1-3H3;5-6H2,1-4H3.
What are the key properties of diethoxy(dimethyl)silane;triethoxy(phenyl)silane;3-triethoxysilylpropan-1-amine?
diethoxy(dimethyl)silane;triethoxy(phenyl)silane;3-triethoxysilylpropan-1-amine has a molecular weight of 610.03 g/mol, XLogP of 5.09, 20 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxy(dimethyl)silane;triethoxy(phenyl)silane;3-triethoxysilylpropan-1-amine is sourced from PubChem (CID 6455506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).