C14H17F3N2O — CID 64555084
1-amino-3-methyl-N-(2,4,5-trifluorophenyl)cyclohexane-1-carboxamide (PubChem CID 64555084) has the molecular formula C14H17F3N2O and a molecular weight of 286.30 g/mol. Its IUPAC name is 1-amino-3-methyl-N-(2,4,5-trifluorophenyl)cyclohexane-1-carboxamide.
| Compound Name | 1-amino-3-methyl-N-(2,4,5-trifluorophenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 64555084 |
| Molecular Formula | C14H17F3N2O |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 1-amino-3-methyl-N-(2,4,5-trifluorophenyl)cyclohexane-1-carboxamide |
| SMILES | CC1CCCC(N)(C(=O)Nc2cc(F)c(F)cc2F)C1 |
| InChI | InChI=1S/C14H17F3N2O/c1-8-3-2-4-14(18,7-8)13(20)19-12-6-10(16)9(15)5-11(12)17/h5-6,8H,2-4,7,18H2,1H3,(H,19,20) |
| InChIKey | UQUXOQPCVNBYIT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|