About 4-[(4-aminophenyl)methyl]aniline;2-methyloxirane
4-[(4-aminophenyl)methyl]aniline;2-methyloxirane (PubChem CID 6455563) has the molecular formula C16H20N2O
and a molecular weight of 256.35 g/mol. Its IUPAC name is 4-[(4-aminophenyl)methyl]aniline;2-methyloxirane.
Molecular Properties
| Compound Name | 4-[(4-aminophenyl)methyl]aniline;2-methyloxirane |
| PubChem CID | 6455563 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 4-[(4-aminophenyl)methyl]aniline;2-methyloxirane |
| SMILES | CC1CO1.Nc1ccc(Cc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C13H14N2.C3H6O/c14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11;1-3-2-4-3/h1-8H,9,14-15H2;3H,2H2,1H3 |
| InChIKey | SQFXHRJJKIOUDP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 64.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-aminophenyl)methyl]aniline;2-methyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-aminophenyl)methyl]aniline;2-methyloxirane?
The IUPAC name of 4-[(4-aminophenyl)methyl]aniline;2-methyloxirane (CID 6455563) is 4-[(4-aminophenyl)methyl]aniline;2-methyloxirane.
What is the SMILES notation for 4-[(4-aminophenyl)methyl]aniline;2-methyloxirane?
The canonical SMILES for 4-[(4-aminophenyl)methyl]aniline;2-methyloxirane is CC1CO1.Nc1ccc(Cc2ccc(N)cc2)cc1.
What is the InChIKey of 4-[(4-aminophenyl)methyl]aniline;2-methyloxirane?
The InChIKey is SQFXHRJJKIOUDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2.C3H6O/c14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11;1-3-2-4-3/h1-8H,9,14-15H2;3H,2H2,1H3.
What are the key properties of 4-[(4-aminophenyl)methyl]aniline;2-methyloxirane?
4-[(4-aminophenyl)methyl]aniline;2-methyloxirane has a molecular weight of 256.35 g/mol, XLogP of 2.85, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-aminophenyl)methyl]aniline;2-methyloxirane is sourced from PubChem (CID 6455563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).