About 3-methyl-4H-1,2-oxazol-5-one;morpholine
3-methyl-4H-1,2-oxazol-5-one;morpholine (PubChem CID 6455572) has the molecular formula C8H14N2O3
and a molecular weight of 186.21 g/mol. Its IUPAC name is 3-methyl-4H-1,2-oxazol-5-one;morpholine.
Molecular Properties
| Compound Name | 3-methyl-4H-1,2-oxazol-5-one;morpholine |
| PubChem CID | 6455572 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 3-methyl-4H-1,2-oxazol-5-one;morpholine |
| SMILES | C1COCCN1.CC1=NOC(=O)C1 |
| InChI | InChI=1S/C4H5NO2.C4H9NO/c1-3-2-4(6)7-5-3;1-3-6-4-2-5-1/h2H2,1H3;5H,1-4H2 |
| InChIKey | UNTXTXCRCQLVPT-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-4H-1,2-oxazol-5-one;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4H-1,2-oxazol-5-one;morpholine?
The IUPAC name of 3-methyl-4H-1,2-oxazol-5-one;morpholine (CID 6455572) is 3-methyl-4H-1,2-oxazol-5-one;morpholine.
What is the SMILES notation for 3-methyl-4H-1,2-oxazol-5-one;morpholine?
The canonical SMILES for 3-methyl-4H-1,2-oxazol-5-one;morpholine is C1COCCN1.CC1=NOC(=O)C1.
What is the InChIKey of 3-methyl-4H-1,2-oxazol-5-one;morpholine?
The InChIKey is UNTXTXCRCQLVPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2.C4H9NO/c1-3-2-4(6)7-5-3;1-3-6-4-2-5-1/h2H2,1H3;5H,1-4H2.
What are the key properties of 3-methyl-4H-1,2-oxazol-5-one;morpholine?
3-methyl-4H-1,2-oxazol-5-one;morpholine has a molecular weight of 186.21 g/mol, XLogP of -0.08, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4H-1,2-oxazol-5-one;morpholine is sourced from PubChem (CID 6455572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).