C16H22O11 — CID 6455726
[(2S,3S,4S,5R,6R)-2,3,4-triacetyl-2-acetyloxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] acetate (PubChem CID 6455726) has the molecular formula C16H22O11 and a molecular weight of 390.34 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6R)-2,3,4-triacetyl-2-acetyloxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] acetate.
| Compound Name | [(2S,3S,4S,5R,6R)-2,3,4-triacetyl-2-acetyloxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 6455726 |
| Molecular Formula | C16H22O11 |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | [(2S,3S,4S,5R,6R)-2,3,4-triacetyl-2-acetyloxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@]1(C(C)=O)O[C@H](CO)[C@@H](O)[C@@](O)(C(C)=O)[C@]1(OC(C)=O)C(C)=O |
| InChI | InChI=1S/C16H22O11/c1-7(18)14(24)13(23)12(6-17)27-16(9(3)20,26-11(5)22)15(14,8(2)19)25-10(4)21/h12-13,17,23-24H,6H2,1-5H3/t12-,13-,14+,15-,16+/m1/s1 |
| InChIKey | CROSTDAMOFQQPQ-LJIZCISZSA-N |
| XLogP | -2.20 |
| TPSA | 173.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |