About N'-(2-aminoethyl)ethane-1,2-diamine;2-nonylphenol
N'-(2-aminoethyl)ethane-1,2-diamine;2-nonylphenol (PubChem CID 6455750) has the molecular formula C19H37N3O
and a molecular weight of 323.53 g/mol. Its IUPAC name is N'-(2-aminoethyl)ethane-1,2-diamine;2-nonylphenol.
Molecular Properties
| Compound Name | N'-(2-aminoethyl)ethane-1,2-diamine;2-nonylphenol |
| PubChem CID | 6455750 |
| Molecular Formula | C19H37N3O |
| Molecular Weight | 323.53 g/mol |
| Exact Mass | 323.29 |
| IUPAC Name | N'-(2-aminoethyl)ethane-1,2-diamine;2-nonylphenol |
| SMILES | CCCCCCCCCc1ccccc1O.NCCNCCN |
| InChI | InChI=1S/C15H24O.C4H13N3/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)16;5-1-3-7-4-2-6/h9-10,12-13,16H,2-8,11H2,1H3;7H,1-6H2 |
| InChIKey | RAAHUNANUQVROX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-aminoethyl)ethane-1,2-diamine;2-nonylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-aminoethyl)ethane-1,2-diamine;2-nonylphenol?
The IUPAC name of N'-(2-aminoethyl)ethane-1,2-diamine;2-nonylphenol (CID 6455750) is N'-(2-aminoethyl)ethane-1,2-diamine;2-nonylphenol.
What is the SMILES notation for N'-(2-aminoethyl)ethane-1,2-diamine;2-nonylphenol?
The canonical SMILES for N'-(2-aminoethyl)ethane-1,2-diamine;2-nonylphenol is CCCCCCCCCc1ccccc1O.NCCNCCN.
What is the InChIKey of N'-(2-aminoethyl)ethane-1,2-diamine;2-nonylphenol?
The InChIKey is RAAHUNANUQVROX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O.C4H13N3/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)16;5-1-3-7-4-2-6/h9-10,12-13,16H,2-8,11H2,1H3;7H,1-6H2.
What are the key properties of N'-(2-aminoethyl)ethane-1,2-diamine;2-nonylphenol?
N'-(2-aminoethyl)ethane-1,2-diamine;2-nonylphenol has a molecular weight of 323.53 g/mol, XLogP of 3.18, 12 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-aminoethyl)ethane-1,2-diamine;2-nonylphenol is sourced from PubChem (CID 6455750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).