About amino(cyclohexyl)azanium;hydrogen sulfate
amino(cyclohexyl)azanium;hydrogen sulfate (PubChem CID 6455771) has the molecular formula C6H16N2O4S
and a molecular weight of 212.27 g/mol. Its IUPAC name is amino(cyclohexyl)azanium;hydrogen sulfate.
Molecular Properties
| Compound Name | amino(cyclohexyl)azanium;hydrogen sulfate |
| PubChem CID | 6455771 |
| Molecular Formula | C6H16N2O4S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | amino(cyclohexyl)azanium;hydrogen sulfate |
| SMILES | N[NH2+]C1CCCCC1.O=S(=O)([O-])O |
| InChI | InChI=1S/C6H14N2.H2O4S/c7-8-6-4-2-1-3-5-6;1-5(2,3)4/h6,8H,1-5,7H2;(H2,1,2,3,4) |
| InChIKey | HYGTVVBJPFJRKV-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 120.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze amino(cyclohexyl)azanium;hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino(cyclohexyl)azanium;hydrogen sulfate?
The IUPAC name of amino(cyclohexyl)azanium;hydrogen sulfate (CID 6455771) is amino(cyclohexyl)azanium;hydrogen sulfate.
What is the SMILES notation for amino(cyclohexyl)azanium;hydrogen sulfate?
The canonical SMILES for amino(cyclohexyl)azanium;hydrogen sulfate is N[NH2+]C1CCCCC1.O=S(=O)([O-])O.
What is the InChIKey of amino(cyclohexyl)azanium;hydrogen sulfate?
The InChIKey is HYGTVVBJPFJRKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2.H2O4S/c7-8-6-4-2-1-3-5-6;1-5(2,3)4/h6,8H,1-5,7H2;(H2,1,2,3,4).
What are the key properties of amino(cyclohexyl)azanium;hydrogen sulfate?
amino(cyclohexyl)azanium;hydrogen sulfate has a molecular weight of 212.27 g/mol, XLogP of -1.24, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for amino(cyclohexyl)azanium;hydrogen sulfate is sourced from PubChem (CID 6455771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).