About N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;terephthalic acid
N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;terephthalic acid (PubChem CID 6455788) has the molecular formula C14H24N4O4
and a molecular weight of 312.37 g/mol. Its IUPAC name is N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;terephthalic acid.
Molecular Properties
| Compound Name | N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;terephthalic acid |
| PubChem CID | 6455788 |
| Molecular Formula | C14H24N4O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;terephthalic acid |
| SMILES | NCCNCCNCCN.O=C(O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C8H6O4.C6H18N4/c9-7(10)5-1-2-6(4-3-5)8(11)12;7-1-3-9-5-6-10-4-2-8/h1-4H,(H,9,10)(H,11,12);9-10H,1-8H2 |
| InChIKey | OYFGMZMOWNKEEH-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;terephthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;terephthalic acid?
The IUPAC name of N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;terephthalic acid (CID 6455788) is N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;terephthalic acid.
What is the SMILES notation for N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;terephthalic acid?
The canonical SMILES for N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;terephthalic acid is NCCNCCNCCN.O=C(O)c1ccc(C(=O)O)cc1.
What is the InChIKey of N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;terephthalic acid?
The InChIKey is OYFGMZMOWNKEEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4.C6H18N4/c9-7(10)5-1-2-6(4-3-5)8(11)12;7-1-3-9-5-6-10-4-2-8/h1-4H,(H,9,10)(H,11,12);9-10H,1-8H2.
What are the key properties of N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;terephthalic acid?
N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;terephthalic acid has a molecular weight of 312.37 g/mol, XLogP of -0.83, 9 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;terephthalic acid is sourced from PubChem (CID 6455788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).