C14H24N2O3S — CID 64558207
4-[(1-hydroxy-2-methylbutan-2-yl)amino]-N-propan-2-ylbenzenesulfonamide (PubChem CID 64558207) has the molecular formula C14H24N2O3S and a molecular weight of 300.42 g/mol. Its IUPAC name is 4-[(1-hydroxy-2-methylbutan-2-yl)amino]-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 4-[(1-hydroxy-2-methylbutan-2-yl)amino]-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 64558207 |
| Molecular Formula | C14H24N2O3S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 4-[(1-hydroxy-2-methylbutan-2-yl)amino]-N-propan-2-ylbenzenesulfonamide |
| SMILES | CCC(C)(CO)Nc1ccc(S(=O)(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C14H24N2O3S/c1-5-14(4,10-17)15-12-6-8-13(9-7-12)20(18,19)16-11(2)3/h6-9,11,15-17H,5,10H2,1-4H3 |
| InChIKey | IDGNDXHPRPDEON-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |