About N-methyl-N-prop-2-enylprop-2-en-1-amine;prop-2-enamide;hydrochloride
N-methyl-N-prop-2-enylprop-2-en-1-amine;prop-2-enamide;hydrochloride (PubChem CID 6455829) has the molecular formula C10H19ClN2O
and a molecular weight of 218.73 g/mol. Its IUPAC name is N-methyl-N-prop-2-enylprop-2-en-1-amine;prop-2-enamide;hydrochloride.
Molecular Properties
| Compound Name | N-methyl-N-prop-2-enylprop-2-en-1-amine;prop-2-enamide;hydrochloride |
| PubChem CID | 6455829 |
| Molecular Formula | C10H19ClN2O |
| Molecular Weight | 218.73 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | N-methyl-N-prop-2-enylprop-2-en-1-amine;prop-2-enamide;hydrochloride |
| SMILES | C=CC(N)=O.C=CCN(C)CC=C.Cl |
| InChI | InChI=1S/C7H13N.C3H5NO.ClH/c1-4-6-8(3)7-5-2;1-2-3(4)5;/h4-5H,1-2,6-7H2,3H3;2H,1H2,(H2,4,5);1H |
| InChIKey | RXXVPOFDVZHBNV-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.73 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-prop-2-enylprop-2-en-1-amine;prop-2-enamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-prop-2-enylprop-2-en-1-amine;prop-2-enamide;hydrochloride?
The IUPAC name of N-methyl-N-prop-2-enylprop-2-en-1-amine;prop-2-enamide;hydrochloride (CID 6455829) is N-methyl-N-prop-2-enylprop-2-en-1-amine;prop-2-enamide;hydrochloride.
What is the SMILES notation for N-methyl-N-prop-2-enylprop-2-en-1-amine;prop-2-enamide;hydrochloride?
The canonical SMILES for N-methyl-N-prop-2-enylprop-2-en-1-amine;prop-2-enamide;hydrochloride is C=CC(N)=O.C=CCN(C)CC=C.Cl.
What is the InChIKey of N-methyl-N-prop-2-enylprop-2-en-1-amine;prop-2-enamide;hydrochloride?
The InChIKey is RXXVPOFDVZHBNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N.C3H5NO.ClH/c1-4-6-8(3)7-5-2;1-2-3(4)5;/h4-5H,1-2,6-7H2,3H3;2H,1H2,(H2,4,5);1H.
What are the key properties of N-methyl-N-prop-2-enylprop-2-en-1-amine;prop-2-enamide;hydrochloride?
N-methyl-N-prop-2-enylprop-2-en-1-amine;prop-2-enamide;hydrochloride has a molecular weight of 218.73 g/mol, XLogP of 1.37, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-prop-2-enylprop-2-en-1-amine;prop-2-enamide;hydrochloride is sourced from PubChem (CID 6455829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).