About styrene;1,2-xylene
styrene;1,2-xylene (PubChem CID 6455840) has the molecular formula C16H18
and a molecular weight of 210.32 g/mol. Its IUPAC name is styrene;1,2-xylene.
Molecular Properties
| Compound Name | styrene;1,2-xylene |
| PubChem CID | 6455840 |
| Molecular Formula | C16H18 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | styrene;1,2-xylene |
| SMILES | C=Cc1ccccc1.Cc1ccccc1C |
| InChI | InChI=1S/C8H10.C8H8/c1-7-5-3-4-6-8(7)2;1-2-8-6-4-3-5-7-8/h3-6H,1-2H3;2-7H,1H2 |
| InChIKey | JOPUGMCRSOXVGT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze styrene;1,2-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of styrene;1,2-xylene?
The IUPAC name of styrene;1,2-xylene (CID 6455840) is styrene;1,2-xylene.
What is the SMILES notation for styrene;1,2-xylene?
The canonical SMILES for styrene;1,2-xylene is C=Cc1ccccc1.Cc1ccccc1C.
What is the InChIKey of styrene;1,2-xylene?
The InChIKey is JOPUGMCRSOXVGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.C8H8/c1-7-5-3-4-6-8(7)2;1-2-8-6-4-3-5-7-8/h3-6H,1-2H3;2-7H,1H2.
What are the key properties of styrene;1,2-xylene?
styrene;1,2-xylene has a molecular weight of 210.32 g/mol, XLogP of 4.63, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for styrene;1,2-xylene is sourced from PubChem (CID 6455840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).