About formaldehyde;4-(4-hydroxyphenyl)sulfanylphenol;4-(2,4,4-trimethylpentan-2-yl)phenol
formaldehyde;4-(4-hydroxyphenyl)sulfanylphenol;4-(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 6455864) has the molecular formula C27H34O4S
and a molecular weight of 454.63 g/mol. Its IUPAC name is formaldehyde;4-(4-hydroxyphenyl)sulfanylphenol;4-(2,4,4-trimethylpentan-2-yl)phenol.
Molecular Properties
| Compound Name | formaldehyde;4-(4-hydroxyphenyl)sulfanylphenol;4-(2,4,4-trimethylpentan-2-yl)phenol |
| PubChem CID | 6455864 |
| Molecular Formula | C27H34O4S |
| Molecular Weight | 454.63 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | formaldehyde;4-(4-hydroxyphenyl)sulfanylphenol;4-(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | C=O.CC(C)(C)CC(C)(C)c1ccc(O)cc1.Oc1ccc(Sc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C14H22O.C12H10O2S.CH2O/c1-13(2,3)10-14(4,5)11-6-8-12(15)9-7-11;13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12;1-2/h6-9,15H,10H2,1-5H3;1-8,13-14H;1H2 |
| InChIKey | PDHFCNRBVVODOM-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.63 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze formaldehyde;4-(4-hydroxyphenyl)sulfanylphenol;4-(2,4,4-trimethylpentan-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;4-(4-hydroxyphenyl)sulfanylphenol;4-(2,4,4-trimethylpentan-2-yl)phenol?
The IUPAC name of formaldehyde;4-(4-hydroxyphenyl)sulfanylphenol;4-(2,4,4-trimethylpentan-2-yl)phenol (CID 6455864) is formaldehyde;4-(4-hydroxyphenyl)sulfanylphenol;4-(2,4,4-trimethylpentan-2-yl)phenol.
What is the SMILES notation for formaldehyde;4-(4-hydroxyphenyl)sulfanylphenol;4-(2,4,4-trimethylpentan-2-yl)phenol?
The canonical SMILES for formaldehyde;4-(4-hydroxyphenyl)sulfanylphenol;4-(2,4,4-trimethylpentan-2-yl)phenol is C=O.CC(C)(C)CC(C)(C)c1ccc(O)cc1.Oc1ccc(Sc2ccc(O)cc2)cc1.
What is the InChIKey of formaldehyde;4-(4-hydroxyphenyl)sulfanylphenol;4-(2,4,4-trimethylpentan-2-yl)phenol?
The InChIKey is PDHFCNRBVVODOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O.C12H10O2S.CH2O/c1-13(2,3)10-14(4,5)11-6-8-12(15)9-7-11;13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12;1-2/h6-9,15H,10H2,1-5H3;1-8,13-14H;1H2.
What are the key properties of formaldehyde;4-(4-hydroxyphenyl)sulfanylphenol;4-(2,4,4-trimethylpentan-2-yl)phenol?
formaldehyde;4-(4-hydroxyphenyl)sulfanylphenol;4-(2,4,4-trimethylpentan-2-yl)phenol has a molecular weight of 454.63 g/mol, XLogP of 7.17, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;4-(4-hydroxyphenyl)sulfanylphenol;4-(2,4,4-trimethylpentan-2-yl)phenol is sourced from PubChem (CID 6455864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).