C16H25F2N — CID 64558725
2-(2,4-difluorophenyl)-N-ethyl-2-propylpentan-1-amine (PubChem CID 64558725) has the molecular formula C16H25F2N and a molecular weight of 269.38 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-N-ethyl-2-propylpentan-1-amine.
| Compound Name | 2-(2,4-difluorophenyl)-N-ethyl-2-propylpentan-1-amine |
|---|---|
| PubChem CID | 64558725 |
| Molecular Formula | C16H25F2N |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | 2-(2,4-difluorophenyl)-N-ethyl-2-propylpentan-1-amine |
| SMILES | CCCC(CCC)(CNCC)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H25F2N/c1-4-9-16(10-5-2,12-19-6-3)14-8-7-13(17)11-15(14)18/h7-8,11,19H,4-6,9-10,12H2,1-3H3 |
| InChIKey | IRWFARJFERNNAY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |