About 4-(2,4-difluorophenyl)-5-(oxan-3-yl)-1H-pyrazol-3-amine
4-(2,4-difluorophenyl)-5-(oxan-3-yl)-1H-pyrazol-3-amine (PubChem CID 64559125) has the molecular formula C14H15F2N3O
and a molecular weight of 279.29 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-5-(oxan-3-yl)-1H-pyrazol-3-amine.
Molecular Properties
| Compound Name | 4-(2,4-difluorophenyl)-5-(oxan-3-yl)-1H-pyrazol-3-amine |
| PubChem CID | 64559125 |
| Molecular Formula | C14H15F2N3O |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 4-(2,4-difluorophenyl)-5-(oxan-3-yl)-1H-pyrazol-3-amine |
| SMILES | Nc1n[nH]c(C2CCCOC2)c1-c1ccc(F)cc1F |
| InChI | InChI=1S/C14H15F2N3O/c15-9-3-4-10(11(16)6-9)12-13(18-19-14(12)17)8-2-1-5-20-7-8/h3-4,6,8H,1-2,5,7H2,(H3,17,18,19) |
| InChIKey | AGBHNKNVYBFYRM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2,4-difluorophenyl)-5-(oxan-3-yl)-1H-pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-difluorophenyl)-5-(oxan-3-yl)-1H-pyrazol-3-amine?
The IUPAC name of 4-(2,4-difluorophenyl)-5-(oxan-3-yl)-1H-pyrazol-3-amine (CID 64559125) is 4-(2,4-difluorophenyl)-5-(oxan-3-yl)-1H-pyrazol-3-amine.
What is the SMILES notation for 4-(2,4-difluorophenyl)-5-(oxan-3-yl)-1H-pyrazol-3-amine?
The canonical SMILES for 4-(2,4-difluorophenyl)-5-(oxan-3-yl)-1H-pyrazol-3-amine is Nc1n[nH]c(C2CCCOC2)c1-c1ccc(F)cc1F.
What is the InChIKey of 4-(2,4-difluorophenyl)-5-(oxan-3-yl)-1H-pyrazol-3-amine?
The InChIKey is AGBHNKNVYBFYRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F2N3O/c15-9-3-4-10(11(16)6-9)12-13(18-19-14(12)17)8-2-1-5-20-7-8/h3-4,6,8H,1-2,5,7H2,(H3,17,18,19).
What are the key properties of 4-(2,4-difluorophenyl)-5-(oxan-3-yl)-1H-pyrazol-3-amine?
4-(2,4-difluorophenyl)-5-(oxan-3-yl)-1H-pyrazol-3-amine has a molecular weight of 279.29 g/mol, XLogP of 2.83, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-difluorophenyl)-5-(oxan-3-yl)-1H-pyrazol-3-amine is sourced from PubChem (CID 64559125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).