About N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;(Z)-octadec-9-enoic acid
N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;(Z)-octadec-9-enoic acid (PubChem CID 6455972) has the molecular formula C24H52N4O2
and a molecular weight of 428.71 g/mol. Its IUPAC name is N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;(Z)-octadec-9-enoic acid.
Molecular Properties
| Compound Name | N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;(Z)-octadec-9-enoic acid |
| PubChem CID | 6455972 |
| Molecular Formula | C24H52N4O2 |
| Molecular Weight | 428.71 g/mol |
| Exact Mass | 428.41 |
| IUPAC Name | N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;(Z)-octadec-9-enoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O.NCCNCCNCCN |
| InChI | InChI=1S/C18H34O2.C6H18N4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;7-1-3-9-5-6-10-4-2-8/h9-10H,2-8,11-17H2,1H3,(H,19,20);9-10H,1-8H2/b10-9-; |
| InChIKey | URYCKQULNLXTPQ-KVVVOXFISA-N |
| XLogP | 4.19 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.71 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;(Z)-octadec-9-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;(Z)-octadec-9-enoic acid?
The IUPAC name of N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;(Z)-octadec-9-enoic acid (CID 6455972) is N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;(Z)-octadec-9-enoic acid.
What is the SMILES notation for N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;(Z)-octadec-9-enoic acid?
The canonical SMILES for N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;(Z)-octadec-9-enoic acid is CCCCCCCC/C=C\CCCCCCCC(=O)O.NCCNCCNCCN.
What is the InChIKey of N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;(Z)-octadec-9-enoic acid?
The InChIKey is URYCKQULNLXTPQ-KVVVOXFISA-N. The full InChI is InChI=1S/C18H34O2.C6H18N4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;7-1-3-9-5-6-10-4-2-8/h9-10H,2-8,11-17H2,1H3,(H,19,20);9-10H,1-8H2/b10-9-;.
What are the key properties of N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;(Z)-octadec-9-enoic acid?
N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;(Z)-octadec-9-enoic acid has a molecular weight of 428.71 g/mol, XLogP of 4.19, 22 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;(Z)-octadec-9-enoic acid is sourced from PubChem (CID 6455972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).