About 3-amino-2-phenylimino-1,3-thiazolidin-4-one
3-amino-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 6456050) has the molecular formula C9H9N3OS
and a molecular weight of 207.26 g/mol. Its IUPAC name is 3-amino-2-phenylimino-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 3-amino-2-phenylimino-1,3-thiazolidin-4-one |
| PubChem CID | 6456050 |
| Molecular Formula | C9H9N3OS |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 3-amino-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | NN1C(=O)CS/C1=N\c1ccccc1 |
| InChI | InChI=1S/C9H9N3OS/c10-12-8(13)6-14-9(12)11-7-4-2-1-3-5-7/h1-5H,6,10H2/b11-9- |
| InChIKey | IIBRMIIEVISXSO-LUAWRHEFSA-N |
| XLogP | 1.12 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-phenylimino-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-phenylimino-1,3-thiazolidin-4-one?
The IUPAC name of 3-amino-2-phenylimino-1,3-thiazolidin-4-one (CID 6456050) is 3-amino-2-phenylimino-1,3-thiazolidin-4-one.
What is the SMILES notation for 3-amino-2-phenylimino-1,3-thiazolidin-4-one?
The canonical SMILES for 3-amino-2-phenylimino-1,3-thiazolidin-4-one is NN1C(=O)CS/C1=N\c1ccccc1.
What is the InChIKey of 3-amino-2-phenylimino-1,3-thiazolidin-4-one?
The InChIKey is IIBRMIIEVISXSO-LUAWRHEFSA-N. The full InChI is InChI=1S/C9H9N3OS/c10-12-8(13)6-14-9(12)11-7-4-2-1-3-5-7/h1-5H,6,10H2/b11-9-.
What are the key properties of 3-amino-2-phenylimino-1,3-thiazolidin-4-one?
3-amino-2-phenylimino-1,3-thiazolidin-4-one has a molecular weight of 207.26 g/mol, XLogP of 1.12, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-phenylimino-1,3-thiazolidin-4-one is sourced from PubChem (CID 6456050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).