C16H19F2N3 — CID 64561244
5-cycloheptyl-4-(2,4-difluorophenyl)-1H-pyrazol-3-amine (PubChem CID 64561244) has the molecular formula C16H19F2N3 and a molecular weight of 291.34 g/mol. Its IUPAC name is 5-cycloheptyl-4-(2,4-difluorophenyl)-1H-pyrazol-3-amine.
| Compound Name | 5-cycloheptyl-4-(2,4-difluorophenyl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 64561244 |
| Molecular Formula | C16H19F2N3 |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 5-cycloheptyl-4-(2,4-difluorophenyl)-1H-pyrazol-3-amine |
| SMILES | Nc1n[nH]c(C2CCCCCC2)c1-c1ccc(F)cc1F |
| InChI | InChI=1S/C16H19F2N3/c17-11-7-8-12(13(18)9-11)14-15(20-21-16(14)19)10-5-3-1-2-4-6-10/h7-10H,1-6H2,(H3,19,20,21) |
| InChIKey | LIMDFTIYBUBNRG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |