About 5-cycloheptyl-4-(2,4-difluorophenyl)-1H-pyrazol-3-amine
5-cycloheptyl-4-(2,4-difluorophenyl)-1H-pyrazol-3-amine (PubChem CID 64561244) has the molecular formula C16H19F2N3
and a molecular weight of 291.34 g/mol. Its IUPAC name is 5-cycloheptyl-4-(2,4-difluorophenyl)-1H-pyrazol-3-amine.
Molecular Properties
| Compound Name | 5-cycloheptyl-4-(2,4-difluorophenyl)-1H-pyrazol-3-amine |
| PubChem CID | 64561244 |
| Molecular Formula | C16H19F2N3 |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 5-cycloheptyl-4-(2,4-difluorophenyl)-1H-pyrazol-3-amine |
| SMILES | Nc1n[nH]c(C2CCCCCC2)c1-c1ccc(F)cc1F |
| InChI | InChI=1S/C16H19F2N3/c17-11-7-8-12(13(18)9-11)14-15(20-21-16(14)19)10-5-3-1-2-4-6-10/h7-10H,1-6H2,(H3,19,20,21) |
| InChIKey | LIMDFTIYBUBNRG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-cycloheptyl-4-(2,4-difluorophenyl)-1H-pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cycloheptyl-4-(2,4-difluorophenyl)-1H-pyrazol-3-amine?
The IUPAC name of 5-cycloheptyl-4-(2,4-difluorophenyl)-1H-pyrazol-3-amine (CID 64561244) is 5-cycloheptyl-4-(2,4-difluorophenyl)-1H-pyrazol-3-amine.
What is the SMILES notation for 5-cycloheptyl-4-(2,4-difluorophenyl)-1H-pyrazol-3-amine?
The canonical SMILES for 5-cycloheptyl-4-(2,4-difluorophenyl)-1H-pyrazol-3-amine is Nc1n[nH]c(C2CCCCCC2)c1-c1ccc(F)cc1F.
What is the InChIKey of 5-cycloheptyl-4-(2,4-difluorophenyl)-1H-pyrazol-3-amine?
The InChIKey is LIMDFTIYBUBNRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F2N3/c17-11-7-8-12(13(18)9-11)14-15(20-21-16(14)19)10-5-3-1-2-4-6-10/h7-10H,1-6H2,(H3,19,20,21).
What are the key properties of 5-cycloheptyl-4-(2,4-difluorophenyl)-1H-pyrazol-3-amine?
5-cycloheptyl-4-(2,4-difluorophenyl)-1H-pyrazol-3-amine has a molecular weight of 291.34 g/mol, XLogP of 4.37, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cycloheptyl-4-(2,4-difluorophenyl)-1H-pyrazol-3-amine is sourced from PubChem (CID 64561244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).