About 8-(azepan-1-yl)-1,3-dimethyl-7-phenacylpurine-2,6-dione
8-(azepan-1-yl)-1,3-dimethyl-7-phenacylpurine-2,6-dione (PubChem CID 645616) has the molecular formula C21H25N5O3
and a molecular weight of 395.46 g/mol. Its IUPAC name is 8-(azepan-1-yl)-1,3-dimethyl-7-phenacylpurine-2,6-dione.
Molecular Properties
| Compound Name | 8-(azepan-1-yl)-1,3-dimethyl-7-phenacylpurine-2,6-dione |
| PubChem CID | 645616 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 8-(azepan-1-yl)-1,3-dimethyl-7-phenacylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(N3CCCCCC3)n2CC(=O)c2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C21H25N5O3/c1-23-18-17(19(28)24(2)21(23)29)26(14-16(27)15-10-6-5-7-11-15)20(22-18)25-12-8-3-4-9-13-25/h5-7,10-11H,3-4,8-9,12-14H2,1-2H3 |
| InChIKey | LZRWUNJOJNESJL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 82.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 8-(azepan-1-yl)-1,3-dimethyl-7-phenacylpurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(azepan-1-yl)-1,3-dimethyl-7-phenacylpurine-2,6-dione?
The IUPAC name of 8-(azepan-1-yl)-1,3-dimethyl-7-phenacylpurine-2,6-dione (CID 645616) is 8-(azepan-1-yl)-1,3-dimethyl-7-phenacylpurine-2,6-dione.
What is the SMILES notation for 8-(azepan-1-yl)-1,3-dimethyl-7-phenacylpurine-2,6-dione?
The canonical SMILES for 8-(azepan-1-yl)-1,3-dimethyl-7-phenacylpurine-2,6-dione is Cn1c(=O)c2c(nc(N3CCCCCC3)n2CC(=O)c2ccccc2)n(C)c1=O.
What is the InChIKey of 8-(azepan-1-yl)-1,3-dimethyl-7-phenacylpurine-2,6-dione?
The InChIKey is LZRWUNJOJNESJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N5O3/c1-23-18-17(19(28)24(2)21(23)29)26(14-16(27)15-10-6-5-7-11-15)20(22-18)25-12-8-3-4-9-13-25/h5-7,10-11H,3-4,8-9,12-14H2,1-2H3.
What are the key properties of 8-(azepan-1-yl)-1,3-dimethyl-7-phenacylpurine-2,6-dione?
8-(azepan-1-yl)-1,3-dimethyl-7-phenacylpurine-2,6-dione has a molecular weight of 395.46 g/mol, XLogP of 1.70, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(azepan-1-yl)-1,3-dimethyl-7-phenacylpurine-2,6-dione is sourced from PubChem (CID 645616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).