About 4-[(2,4-difluorophenyl)methyl]-2,6-dimethylmorpholine
4-[(2,4-difluorophenyl)methyl]-2,6-dimethylmorpholine (PubChem CID 6456202) has the molecular formula C13H17F2NO
and a molecular weight of 241.28 g/mol. Its IUPAC name is 4-[(2,4-difluorophenyl)methyl]-2,6-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-[(2,4-difluorophenyl)methyl]-2,6-dimethylmorpholine |
| PubChem CID | 6456202 |
| Molecular Formula | C13H17F2NO |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 4-[(2,4-difluorophenyl)methyl]-2,6-dimethylmorpholine |
| SMILES | CC1CN(Cc2ccc(F)cc2F)CC(C)O1 |
| InChI | InChI=1S/C13H17F2NO/c1-9-6-16(7-10(2)17-9)8-11-3-4-12(14)5-13(11)15/h3-5,9-10H,6-8H2,1-2H3 |
| InChIKey | VMZLJDJODGHFPC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(2,4-difluorophenyl)methyl]-2,6-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,4-difluorophenyl)methyl]-2,6-dimethylmorpholine?
The IUPAC name of 4-[(2,4-difluorophenyl)methyl]-2,6-dimethylmorpholine (CID 6456202) is 4-[(2,4-difluorophenyl)methyl]-2,6-dimethylmorpholine.
What is the SMILES notation for 4-[(2,4-difluorophenyl)methyl]-2,6-dimethylmorpholine?
The canonical SMILES for 4-[(2,4-difluorophenyl)methyl]-2,6-dimethylmorpholine is CC1CN(Cc2ccc(F)cc2F)CC(C)O1.
What is the InChIKey of 4-[(2,4-difluorophenyl)methyl]-2,6-dimethylmorpholine?
The InChIKey is VMZLJDJODGHFPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F2NO/c1-9-6-16(7-10(2)17-9)8-11-3-4-12(14)5-13(11)15/h3-5,9-10H,6-8H2,1-2H3.
What are the key properties of 4-[(2,4-difluorophenyl)methyl]-2,6-dimethylmorpholine?
4-[(2,4-difluorophenyl)methyl]-2,6-dimethylmorpholine has a molecular weight of 241.28 g/mol, XLogP of 2.57, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,4-difluorophenyl)methyl]-2,6-dimethylmorpholine is sourced from PubChem (CID 6456202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).