C9H17N3O3S — CID 64562309
2-isocyanato-N,N-dimethylazepane-1-sulfonamide (PubChem CID 64562309) has the molecular formula C9H17N3O3S and a molecular weight of 247.32 g/mol. Its IUPAC name is 2-isocyanato-N,N-dimethylazepane-1-sulfonamide.
| Compound Name | 2-isocyanato-N,N-dimethylazepane-1-sulfonamide |
|---|---|
| PubChem CID | 64562309 |
| Molecular Formula | C9H17N3O3S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 2-isocyanato-N,N-dimethylazepane-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCCCCC1N=C=O |
| InChI | InChI=1S/C9H17N3O3S/c1-11(2)16(14,15)12-7-5-3-4-6-9(12)10-8-13/h9H,3-7H2,1-2H3 |
| InChIKey | IBPNHXBMOQMTRT-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|