C14H25N3O4 — CID 64562334
1-[4-(2-hydroxyethyl)piperazine-1-carbonyl]azepane-2-carboxylic acid (PubChem CID 64562334) has the molecular formula C14H25N3O4 and a molecular weight of 299.37 g/mol. Its IUPAC name is 1-[4-(2-hydroxyethyl)piperazine-1-carbonyl]azepane-2-carboxylic acid.
| Compound Name | 1-[4-(2-hydroxyethyl)piperazine-1-carbonyl]azepane-2-carboxylic acid |
|---|---|
| PubChem CID | 64562334 |
| Molecular Formula | C14H25N3O4 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 1-[4-(2-hydroxyethyl)piperazine-1-carbonyl]azepane-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCCN1C(=O)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C14H25N3O4/c18-11-10-15-6-8-16(9-7-15)14(21)17-5-3-1-2-4-12(17)13(19)20/h12,18H,1-11H2,(H,19,20) |
| InChIKey | IJXFVOXRSNXZGK-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |