C17H25N3O — CID 64562834
N-(4-pyrrolidin-1-ylphenyl)azepane-2-carboxamide (PubChem CID 64562834) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is N-(4-pyrrolidin-1-ylphenyl)azepane-2-carboxamide.
| Compound Name | N-(4-pyrrolidin-1-ylphenyl)azepane-2-carboxamide |
|---|---|
| PubChem CID | 64562834 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | N-(4-pyrrolidin-1-ylphenyl)azepane-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)cc1)C1CCCCCN1 |
| InChI | InChI=1S/C17H25N3O/c21-17(16-6-2-1-3-11-18-16)19-14-7-9-15(10-8-14)20-12-4-5-13-20/h7-10,16,18H,1-6,11-13H2,(H,19,21) |
| InChIKey | OQANIKIOULQYJV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|