C15H21N3O2 — CID 64563986
N-[2-(2-amino-2-oxoethyl)phenyl]azepane-2-carboxamide (PubChem CID 64563986) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is N-[2-(2-amino-2-oxoethyl)phenyl]azepane-2-carboxamide.
| Compound Name | N-[2-(2-amino-2-oxoethyl)phenyl]azepane-2-carboxamide |
|---|---|
| PubChem CID | 64563986 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | N-[2-(2-amino-2-oxoethyl)phenyl]azepane-2-carboxamide |
| SMILES | NC(=O)Cc1ccccc1NC(=O)C1CCCCCN1 |
| InChI | InChI=1S/C15H21N3O2/c16-14(19)10-11-6-3-4-7-12(11)18-15(20)13-8-2-1-5-9-17-13/h3-4,6-7,13,17H,1-2,5,8-10H2,(H2,16,19)(H,18,20) |
| InChIKey | UBWYZPWNAUDXCB-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |