About (2E,4E)-5-(4-fluorophenyl)penta-2,4-dien-1-ol
(2E,4E)-5-(4-fluorophenyl)penta-2,4-dien-1-ol (PubChem CID 6456465) has the molecular formula C11H11FO
and a molecular weight of 178.21 g/mol. Its IUPAC name is (2E,4E)-5-(4-fluorophenyl)penta-2,4-dien-1-ol.
Molecular Properties
| Compound Name | (2E,4E)-5-(4-fluorophenyl)penta-2,4-dien-1-ol |
| PubChem CID | 6456465 |
| Molecular Formula | C11H11FO |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | (2E,4E)-5-(4-fluorophenyl)penta-2,4-dien-1-ol |
| SMILES | OC/C=C/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C11H11FO/c12-11-7-5-10(6-8-11)4-2-1-3-9-13/h1-8,13H,9H2/b3-1+,4-2+ |
| InChIKey | ZOHIQKAEFVTMSL-ZPUQHVIOSA-N |
| XLogP | 2.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-5-(4-fluorophenyl)penta-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-5-(4-fluorophenyl)penta-2,4-dien-1-ol?
The IUPAC name of (2E,4E)-5-(4-fluorophenyl)penta-2,4-dien-1-ol (CID 6456465) is (2E,4E)-5-(4-fluorophenyl)penta-2,4-dien-1-ol.
What is the SMILES notation for (2E,4E)-5-(4-fluorophenyl)penta-2,4-dien-1-ol?
The canonical SMILES for (2E,4E)-5-(4-fluorophenyl)penta-2,4-dien-1-ol is OC/C=C/C=C/c1ccc(F)cc1.
What is the InChIKey of (2E,4E)-5-(4-fluorophenyl)penta-2,4-dien-1-ol?
The InChIKey is ZOHIQKAEFVTMSL-ZPUQHVIOSA-N. The full InChI is InChI=1S/C11H11FO/c12-11-7-5-10(6-8-11)4-2-1-3-9-13/h1-8,13H,9H2/b3-1+,4-2+.
What are the key properties of (2E,4E)-5-(4-fluorophenyl)penta-2,4-dien-1-ol?
(2E,4E)-5-(4-fluorophenyl)penta-2,4-dien-1-ol has a molecular weight of 178.21 g/mol, XLogP of 2.39, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-5-(4-fluorophenyl)penta-2,4-dien-1-ol is sourced from PubChem (CID 6456465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).