C16H23NO3 — CID 64564821
methyl 3-[3-(hydroxymethyl)piperidin-1-yl]-2-phenylpropanoate (PubChem CID 64564821) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is methyl 3-[3-(hydroxymethyl)piperidin-1-yl]-2-phenylpropanoate.
| Compound Name | methyl 3-[3-(hydroxymethyl)piperidin-1-yl]-2-phenylpropanoate |
|---|---|
| PubChem CID | 64564821 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | methyl 3-[3-(hydroxymethyl)piperidin-1-yl]-2-phenylpropanoate |
| SMILES | COC(=O)C(CN1CCCC(CO)C1)c1ccccc1 |
| InChI | InChI=1S/C16H23NO3/c1-20-16(19)15(14-7-3-2-4-8-14)11-17-9-5-6-13(10-17)12-18/h2-4,7-8,13,15,18H,5-6,9-12H2,1H3 |
| InChIKey | CKUGIMNSBMSBKJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |