About (2-amino-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl)-(4-methylphenyl)methanone
(2-amino-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl)-(4-methylphenyl)methanone (PubChem CID 6456490) has the molecular formula C17H16N2O2
and a molecular weight of 280.33 g/mol. Its IUPAC name is (2-amino-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl)-(4-methylphenyl)methanone.
Molecular Properties
| Compound Name | (2-amino-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl)-(4-methylphenyl)methanone |
| PubChem CID | 6456490 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | (2-amino-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl)-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)C2N=C(N)OC2c2ccccc2)cc1 |
| InChI | InChI=1S/C17H16N2O2/c1-11-7-9-12(10-8-11)15(20)14-16(21-17(18)19-14)13-5-3-2-4-6-13/h2-10,14,16H,1H3,(H2,18,19) |
| InChIKey | ZVFNZNKNGPKDAP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-amino-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl)-(4-methylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl)-(4-methylphenyl)methanone?
The IUPAC name of (2-amino-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl)-(4-methylphenyl)methanone (CID 6456490) is (2-amino-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl)-(4-methylphenyl)methanone.
What is the SMILES notation for (2-amino-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl)-(4-methylphenyl)methanone?
The canonical SMILES for (2-amino-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl)-(4-methylphenyl)methanone is Cc1ccc(C(=O)C2N=C(N)OC2c2ccccc2)cc1.
What is the InChIKey of (2-amino-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl)-(4-methylphenyl)methanone?
The InChIKey is ZVFNZNKNGPKDAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O2/c1-11-7-9-12(10-8-11)15(20)14-16(21-17(18)19-14)13-5-3-2-4-6-13/h2-10,14,16H,1H3,(H2,18,19).
What are the key properties of (2-amino-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl)-(4-methylphenyl)methanone?
(2-amino-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl)-(4-methylphenyl)methanone has a molecular weight of 280.33 g/mol, XLogP of 2.63, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl)-(4-methylphenyl)methanone is sourced from PubChem (CID 6456490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).