About 5-ethyl-1,1,1-trifluoro-5-phenylheptan-4-amine
5-ethyl-1,1,1-trifluoro-5-phenylheptan-4-amine (PubChem CID 64564957) has the molecular formula C15H22F3N
and a molecular weight of 273.34 g/mol. Its IUPAC name is 5-ethyl-1,1,1-trifluoro-5-phenylheptan-4-amine.
Molecular Properties
| Compound Name | 5-ethyl-1,1,1-trifluoro-5-phenylheptan-4-amine |
| PubChem CID | 64564957 |
| Molecular Formula | C15H22F3N |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 5-ethyl-1,1,1-trifluoro-5-phenylheptan-4-amine |
| SMILES | CCC(CC)(c1ccccc1)C(N)CCC(F)(F)F |
| InChI | InChI=1S/C15H22F3N/c1-3-14(4-2,12-8-6-5-7-9-12)13(19)10-11-15(16,17)18/h5-9,13H,3-4,10-11,19H2,1-2H3 |
| InChIKey | LPXYSKDPLSJVNJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-ethyl-1,1,1-trifluoro-5-phenylheptan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1,1,1-trifluoro-5-phenylheptan-4-amine?
The IUPAC name of 5-ethyl-1,1,1-trifluoro-5-phenylheptan-4-amine (CID 64564957) is 5-ethyl-1,1,1-trifluoro-5-phenylheptan-4-amine.
What is the SMILES notation for 5-ethyl-1,1,1-trifluoro-5-phenylheptan-4-amine?
The canonical SMILES for 5-ethyl-1,1,1-trifluoro-5-phenylheptan-4-amine is CCC(CC)(c1ccccc1)C(N)CCC(F)(F)F.
What is the InChIKey of 5-ethyl-1,1,1-trifluoro-5-phenylheptan-4-amine?
The InChIKey is LPXYSKDPLSJVNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22F3N/c1-3-14(4-2,12-8-6-5-7-9-12)13(19)10-11-15(16,17)18/h5-9,13H,3-4,10-11,19H2,1-2H3.
What are the key properties of 5-ethyl-1,1,1-trifluoro-5-phenylheptan-4-amine?
5-ethyl-1,1,1-trifluoro-5-phenylheptan-4-amine has a molecular weight of 273.34 g/mol, XLogP of 4.41, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1,1,1-trifluoro-5-phenylheptan-4-amine is sourced from PubChem (CID 64564957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).