C8H9BF3NO3 — CID 64565282
[5-(3,3,3-trifluoropropoxy)-3-pyridinyl]boronic acid (PubChem CID 64565282) has the molecular formula C8H9BF3NO3 and a molecular weight of 234.97 g/mol. Its IUPAC name is [5-(3,3,3-trifluoropropoxy)-3-pyridinyl]boronic acid.
| Compound Name | [5-(3,3,3-trifluoropropoxy)-3-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 64565282 |
| Molecular Formula | C8H9BF3NO3 |
| Molecular Weight | 234.97 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | [5-(3,3,3-trifluoropropoxy)-3-pyridinyl]boronic acid |
| SMILES | OB(O)c1cncc(OCCC(F)(F)F)c1 |
| InChI | InChI=1S/C8H9BF3NO3/c10-8(11,12)1-2-16-7-3-6(9(14)15)4-13-5-7/h3-5,14-15H,1-2H2 |
| InChIKey | DTNLZSAYSXHVRV-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.97 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|