About 3,3,3-trifluoropropyl 2-(4-aminopyrazol-1-yl)acetate
3,3,3-trifluoropropyl 2-(4-aminopyrazol-1-yl)acetate (PubChem CID 64565325) has the molecular formula C8H10F3N3O2
and a molecular weight of 237.18 g/mol. Its IUPAC name is 3,3,3-trifluoropropyl 2-(4-aminopyrazol-1-yl)acetate.
Molecular Properties
| Compound Name | 3,3,3-trifluoropropyl 2-(4-aminopyrazol-1-yl)acetate |
| PubChem CID | 64565325 |
| Molecular Formula | C8H10F3N3O2 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 3,3,3-trifluoropropyl 2-(4-aminopyrazol-1-yl)acetate |
| SMILES | Nc1cnn(CC(=O)OCCC(F)(F)F)c1 |
| InChI | InChI=1S/C8H10F3N3O2/c9-8(10,11)1-2-16-7(15)5-14-4-6(12)3-13-14/h3-4H,1-2,5,12H2 |
| InChIKey | SRGPZTPEIVTMBU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,3,3-trifluoropropyl 2-(4-aminopyrazol-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3,3-trifluoropropyl 2-(4-aminopyrazol-1-yl)acetate?
The IUPAC name of 3,3,3-trifluoropropyl 2-(4-aminopyrazol-1-yl)acetate (CID 64565325) is 3,3,3-trifluoropropyl 2-(4-aminopyrazol-1-yl)acetate.
What is the SMILES notation for 3,3,3-trifluoropropyl 2-(4-aminopyrazol-1-yl)acetate?
The canonical SMILES for 3,3,3-trifluoropropyl 2-(4-aminopyrazol-1-yl)acetate is Nc1cnn(CC(=O)OCCC(F)(F)F)c1.
What is the InChIKey of 3,3,3-trifluoropropyl 2-(4-aminopyrazol-1-yl)acetate?
The InChIKey is SRGPZTPEIVTMBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F3N3O2/c9-8(10,11)1-2-16-7(15)5-14-4-6(12)3-13-14/h3-4H,1-2,5,12H2.
What are the key properties of 3,3,3-trifluoropropyl 2-(4-aminopyrazol-1-yl)acetate?
3,3,3-trifluoropropyl 2-(4-aminopyrazol-1-yl)acetate has a molecular weight of 237.18 g/mol, XLogP of 0.96, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3,3-trifluoropropyl 2-(4-aminopyrazol-1-yl)acetate is sourced from PubChem (CID 64565325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).