C8H7Br2F3O2 — CID 64565557
1-(4,5-dibromofuran-2-yl)-4,4,4-trifluorobutan-1-ol (PubChem CID 64565557) has the molecular formula C8H7Br2F3O2 and a molecular weight of 351.94 g/mol. Its IUPAC name is 1-(4,5-dibromofuran-2-yl)-4,4,4-trifluorobutan-1-ol.
| Compound Name | 1-(4,5-dibromofuran-2-yl)-4,4,4-trifluorobutan-1-ol |
|---|---|
| PubChem CID | 64565557 |
| Molecular Formula | C8H7Br2F3O2 |
| Molecular Weight | 351.94 g/mol |
| Exact Mass | 349.88 |
| IUPAC Name | 1-(4,5-dibromofuran-2-yl)-4,4,4-trifluorobutan-1-ol |
| SMILES | OC(CCC(F)(F)F)c1cc(Br)c(Br)o1 |
| InChI | InChI=1S/C8H7Br2F3O2/c9-4-3-6(15-7(4)10)5(14)1-2-8(11,12)13/h3,5,14H,1-2H2 |
| InChIKey | BWPPGROJDSEZOB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.94 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |