About 2-ethyl-1-(3,3,3-trifluoropropyl)imidazole-4-sulfonyl chloride
2-ethyl-1-(3,3,3-trifluoropropyl)imidazole-4-sulfonyl chloride (PubChem CID 64565742) has the molecular formula C8H10ClF3N2O2S
and a molecular weight of 290.69 g/mol. Its IUPAC name is 2-ethyl-1-(3,3,3-trifluoropropyl)imidazole-4-sulfonyl chloride.
Molecular Properties
| Compound Name | 2-ethyl-1-(3,3,3-trifluoropropyl)imidazole-4-sulfonyl chloride |
| PubChem CID | 64565742 |
| Molecular Formula | C8H10ClF3N2O2S |
| Molecular Weight | 290.69 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 2-ethyl-1-(3,3,3-trifluoropropyl)imidazole-4-sulfonyl chloride |
| SMILES | CCc1nc(S(=O)(=O)Cl)cn1CCC(F)(F)F |
| InChI | InChI=1S/C8H10ClF3N2O2S/c1-2-6-13-7(17(9,15)16)5-14(6)4-3-8(10,11)12/h5H,2-4H2,1H3 |
| InChIKey | MUVPWVLDBIIVNT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.69 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethyl-1-(3,3,3-trifluoropropyl)imidazole-4-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1-(3,3,3-trifluoropropyl)imidazole-4-sulfonyl chloride?
The IUPAC name of 2-ethyl-1-(3,3,3-trifluoropropyl)imidazole-4-sulfonyl chloride (CID 64565742) is 2-ethyl-1-(3,3,3-trifluoropropyl)imidazole-4-sulfonyl chloride.
What is the SMILES notation for 2-ethyl-1-(3,3,3-trifluoropropyl)imidazole-4-sulfonyl chloride?
The canonical SMILES for 2-ethyl-1-(3,3,3-trifluoropropyl)imidazole-4-sulfonyl chloride is CCc1nc(S(=O)(=O)Cl)cn1CCC(F)(F)F.
What is the InChIKey of 2-ethyl-1-(3,3,3-trifluoropropyl)imidazole-4-sulfonyl chloride?
The InChIKey is MUVPWVLDBIIVNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClF3N2O2S/c1-2-6-13-7(17(9,15)16)5-14(6)4-3-8(10,11)12/h5H,2-4H2,1H3.
What are the key properties of 2-ethyl-1-(3,3,3-trifluoropropyl)imidazole-4-sulfonyl chloride?
2-ethyl-1-(3,3,3-trifluoropropyl)imidazole-4-sulfonyl chloride has a molecular weight of 290.69 g/mol, XLogP of 2.33, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1-(3,3,3-trifluoropropyl)imidazole-4-sulfonyl chloride is sourced from PubChem (CID 64565742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).