About 2-propan-2-yl-1-(3,3,3-trifluoropropyl)imidazole-4-sulfonyl chloride
2-propan-2-yl-1-(3,3,3-trifluoropropyl)imidazole-4-sulfonyl chloride (PubChem CID 64565943) has the molecular formula C9H12ClF3N2O2S
and a molecular weight of 304.72 g/mol. Its IUPAC name is 2-propan-2-yl-1-(3,3,3-trifluoropropyl)imidazole-4-sulfonyl chloride.
Molecular Properties
| Compound Name | 2-propan-2-yl-1-(3,3,3-trifluoropropyl)imidazole-4-sulfonyl chloride |
| PubChem CID | 64565943 |
| Molecular Formula | C9H12ClF3N2O2S |
| Molecular Weight | 304.72 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 2-propan-2-yl-1-(3,3,3-trifluoropropyl)imidazole-4-sulfonyl chloride |
| SMILES | CC(C)c1nc(S(=O)(=O)Cl)cn1CCC(F)(F)F |
| InChI | InChI=1S/C9H12ClF3N2O2S/c1-6(2)8-14-7(18(10,16)17)5-15(8)4-3-9(11,12)13/h5-6H,3-4H2,1-2H3 |
| InChIKey | SWHKQQJXKYCRIQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.72 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-propan-2-yl-1-(3,3,3-trifluoropropyl)imidazole-4-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-1-(3,3,3-trifluoropropyl)imidazole-4-sulfonyl chloride?
The IUPAC name of 2-propan-2-yl-1-(3,3,3-trifluoropropyl)imidazole-4-sulfonyl chloride (CID 64565943) is 2-propan-2-yl-1-(3,3,3-trifluoropropyl)imidazole-4-sulfonyl chloride.
What is the SMILES notation for 2-propan-2-yl-1-(3,3,3-trifluoropropyl)imidazole-4-sulfonyl chloride?
The canonical SMILES for 2-propan-2-yl-1-(3,3,3-trifluoropropyl)imidazole-4-sulfonyl chloride is CC(C)c1nc(S(=O)(=O)Cl)cn1CCC(F)(F)F.
What is the InChIKey of 2-propan-2-yl-1-(3,3,3-trifluoropropyl)imidazole-4-sulfonyl chloride?
The InChIKey is SWHKQQJXKYCRIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12ClF3N2O2S/c1-6(2)8-14-7(18(10,16)17)5-15(8)4-3-9(11,12)13/h5-6H,3-4H2,1-2H3.
What are the key properties of 2-propan-2-yl-1-(3,3,3-trifluoropropyl)imidazole-4-sulfonyl chloride?
2-propan-2-yl-1-(3,3,3-trifluoropropyl)imidazole-4-sulfonyl chloride has a molecular weight of 304.72 g/mol, XLogP of 2.89, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-1-(3,3,3-trifluoropropyl)imidazole-4-sulfonyl chloride is sourced from PubChem (CID 64565943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).