C14H19F3N2O — CID 64565952
1-[3-(3,3,3-trifluoropropoxy)phenyl]piperidin-4-amine (PubChem CID 64565952) has the molecular formula C14H19F3N2O and a molecular weight of 288.31 g/mol. Its IUPAC name is 1-[3-(3,3,3-trifluoropropoxy)phenyl]piperidin-4-amine.
| Compound Name | 1-[3-(3,3,3-trifluoropropoxy)phenyl]piperidin-4-amine |
|---|---|
| PubChem CID | 64565952 |
| Molecular Formula | C14H19F3N2O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 1-[3-(3,3,3-trifluoropropoxy)phenyl]piperidin-4-amine |
| SMILES | NC1CCN(c2cccc(OCCC(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C14H19F3N2O/c15-14(16,17)6-9-20-13-3-1-2-12(10-13)19-7-4-11(18)5-8-19/h1-3,10-11H,4-9,18H2 |
| InChIKey | HHXIQBRCHWPGIM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |