About 3-[2-methylpropyl(3,3,3-trifluoropropyl)amino]propanimidamide
3-[2-methylpropyl(3,3,3-trifluoropropyl)amino]propanimidamide (PubChem CID 64566091) has the molecular formula C10H20F3N3
and a molecular weight of 239.28 g/mol. Its IUPAC name is 3-[2-methylpropyl(3,3,3-trifluoropropyl)amino]propanimidamide.
Molecular Properties
| Compound Name | 3-[2-methylpropyl(3,3,3-trifluoropropyl)amino]propanimidamide |
| PubChem CID | 64566091 |
| Molecular Formula | C10H20F3N3 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 3-[2-methylpropyl(3,3,3-trifluoropropyl)amino]propanimidamide |
| SMILES | [H]/N=C(\N)CCN(CCC(F)(F)F)CC(C)C |
| InChI | InChI=1S/C10H20F3N3/c1-8(2)7-16(5-3-9(14)15)6-4-10(11,12)13/h8H,3-7H2,1-2H3,(H3,14,15) |
| InChIKey | DPEILUXWINGTEM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-methylpropyl(3,3,3-trifluoropropyl)amino]propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-methylpropyl(3,3,3-trifluoropropyl)amino]propanimidamide?
The IUPAC name of 3-[2-methylpropyl(3,3,3-trifluoropropyl)amino]propanimidamide (CID 64566091) is 3-[2-methylpropyl(3,3,3-trifluoropropyl)amino]propanimidamide.
What is the SMILES notation for 3-[2-methylpropyl(3,3,3-trifluoropropyl)amino]propanimidamide?
The canonical SMILES for 3-[2-methylpropyl(3,3,3-trifluoropropyl)amino]propanimidamide is [H]/N=C(\N)CCN(CCC(F)(F)F)CC(C)C.
What is the InChIKey of 3-[2-methylpropyl(3,3,3-trifluoropropyl)amino]propanimidamide?
The InChIKey is DPEILUXWINGTEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20F3N3/c1-8(2)7-16(5-3-9(14)15)6-4-10(11,12)13/h8H,3-7H2,1-2H3,(H3,14,15).
What are the key properties of 3-[2-methylpropyl(3,3,3-trifluoropropyl)amino]propanimidamide?
3-[2-methylpropyl(3,3,3-trifluoropropyl)amino]propanimidamide has a molecular weight of 239.28 g/mol, XLogP of 2.22, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-methylpropyl(3,3,3-trifluoropropyl)amino]propanimidamide is sourced from PubChem (CID 64566091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).