About 4-(3,3,3-trifluoropropoxy)naphthalene-1-sulfonamide
4-(3,3,3-trifluoropropoxy)naphthalene-1-sulfonamide (PubChem CID 64566322) has the molecular formula C13H12F3NO3S
and a molecular weight of 319.30 g/mol. Its IUPAC name is 4-(3,3,3-trifluoropropoxy)naphthalene-1-sulfonamide.
Molecular Properties
| Compound Name | 4-(3,3,3-trifluoropropoxy)naphthalene-1-sulfonamide |
| PubChem CID | 64566322 |
| Molecular Formula | C13H12F3NO3S |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 4-(3,3,3-trifluoropropoxy)naphthalene-1-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(OCCC(F)(F)F)c2ccccc12 |
| InChI | InChI=1S/C13H12F3NO3S/c14-13(15,16)7-8-20-11-5-6-12(21(17,18)19)10-4-2-1-3-9(10)11/h1-6H,7-8H2,(H2,17,18,19) |
| InChIKey | YEIHGKPSNQWOFE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3,3,3-trifluoropropoxy)naphthalene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,3,3-trifluoropropoxy)naphthalene-1-sulfonamide?
The IUPAC name of 4-(3,3,3-trifluoropropoxy)naphthalene-1-sulfonamide (CID 64566322) is 4-(3,3,3-trifluoropropoxy)naphthalene-1-sulfonamide.
What is the SMILES notation for 4-(3,3,3-trifluoropropoxy)naphthalene-1-sulfonamide?
The canonical SMILES for 4-(3,3,3-trifluoropropoxy)naphthalene-1-sulfonamide is NS(=O)(=O)c1ccc(OCCC(F)(F)F)c2ccccc12.
What is the InChIKey of 4-(3,3,3-trifluoropropoxy)naphthalene-1-sulfonamide?
The InChIKey is YEIHGKPSNQWOFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F3NO3S/c14-13(15,16)7-8-20-11-5-6-12(21(17,18)19)10-4-2-1-3-9(10)11/h1-6H,7-8H2,(H2,17,18,19).
What are the key properties of 4-(3,3,3-trifluoropropoxy)naphthalene-1-sulfonamide?
4-(3,3,3-trifluoropropoxy)naphthalene-1-sulfonamide has a molecular weight of 319.30 g/mol, XLogP of 2.82, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3,3-trifluoropropoxy)naphthalene-1-sulfonamide is sourced from PubChem (CID 64566322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).