About 4-propyl-1-(3,3,3-trifluoropropyl)piperidine-4-carboxylic acid
4-propyl-1-(3,3,3-trifluoropropyl)piperidine-4-carboxylic acid (PubChem CID 64566328) has the molecular formula C12H20F3NO2
and a molecular weight of 267.29 g/mol. Its IUPAC name is 4-propyl-1-(3,3,3-trifluoropropyl)piperidine-4-carboxylic acid.
Analyze 4-propyl-1-(3,3,3-trifluoropropyl)piperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propyl-1-(3,3,3-trifluoropropyl)piperidine-4-carboxylic acid?
The IUPAC name of 4-propyl-1-(3,3,3-trifluoropropyl)piperidine-4-carboxylic acid (CID 64566328) is 4-propyl-1-(3,3,3-trifluoropropyl)piperidine-4-carboxylic acid.
What is the SMILES notation for 4-propyl-1-(3,3,3-trifluoropropyl)piperidine-4-carboxylic acid?
The canonical SMILES for 4-propyl-1-(3,3,3-trifluoropropyl)piperidine-4-carboxylic acid is CCCC1(C(=O)O)CCN(CCC(F)(F)F)CC1.
What is the InChIKey of 4-propyl-1-(3,3,3-trifluoropropyl)piperidine-4-carboxylic acid?
The InChIKey is AMIPLQYXYXJAHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F3NO2/c1-2-3-11(10(17)18)4-7-16(8-5-11)9-6-12(13,14)15/h2-9H2,1H3,(H,17,18).
What are the key properties of 4-propyl-1-(3,3,3-trifluoropropyl)piperidine-4-carboxylic acid?
4-propyl-1-(3,3,3-trifluoropropyl)piperidine-4-carboxylic acid has a molecular weight of 267.29 g/mol, XLogP of 2.91, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propyl-1-(3,3,3-trifluoropropyl)piperidine-4-carboxylic acid is sourced from PubChem (CID 64566328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).