About 3-[2-methoxyethyl(3,3,3-trifluoropropyl)amino]propanimidamide
3-[2-methoxyethyl(3,3,3-trifluoropropyl)amino]propanimidamide (PubChem CID 64566496) has the molecular formula C9H18F3N3O
and a molecular weight of 241.26 g/mol. Its IUPAC name is 3-[2-methoxyethyl(3,3,3-trifluoropropyl)amino]propanimidamide.
Molecular Properties
| Compound Name | 3-[2-methoxyethyl(3,3,3-trifluoropropyl)amino]propanimidamide |
| PubChem CID | 64566496 |
| Molecular Formula | C9H18F3N3O |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 3-[2-methoxyethyl(3,3,3-trifluoropropyl)amino]propanimidamide |
| SMILES | [H]/N=C(\N)CCN(CCOC)CCC(F)(F)F |
| InChI | InChI=1S/C9H18F3N3O/c1-16-7-6-15(4-2-8(13)14)5-3-9(10,11)12/h2-7H2,1H3,(H3,13,14) |
| InChIKey | WZLOCWUEPCGTIO-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-methoxyethyl(3,3,3-trifluoropropyl)amino]propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-methoxyethyl(3,3,3-trifluoropropyl)amino]propanimidamide?
The IUPAC name of 3-[2-methoxyethyl(3,3,3-trifluoropropyl)amino]propanimidamide (CID 64566496) is 3-[2-methoxyethyl(3,3,3-trifluoropropyl)amino]propanimidamide.
What is the SMILES notation for 3-[2-methoxyethyl(3,3,3-trifluoropropyl)amino]propanimidamide?
The canonical SMILES for 3-[2-methoxyethyl(3,3,3-trifluoropropyl)amino]propanimidamide is [H]/N=C(\N)CCN(CCOC)CCC(F)(F)F.
What is the InChIKey of 3-[2-methoxyethyl(3,3,3-trifluoropropyl)amino]propanimidamide?
The InChIKey is WZLOCWUEPCGTIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18F3N3O/c1-16-7-6-15(4-2-8(13)14)5-3-9(10,11)12/h2-7H2,1H3,(H3,13,14).
What are the key properties of 3-[2-methoxyethyl(3,3,3-trifluoropropyl)amino]propanimidamide?
3-[2-methoxyethyl(3,3,3-trifluoropropyl)amino]propanimidamide has a molecular weight of 241.26 g/mol, XLogP of 1.21, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-methoxyethyl(3,3,3-trifluoropropyl)amino]propanimidamide is sourced from PubChem (CID 64566496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).