About 2-[cyclopropylmethyl(3,3,3-trifluoropropyl)amino]acetic acid
2-[cyclopropylmethyl(3,3,3-trifluoropropyl)amino]acetic acid (PubChem CID 64566526) has the molecular formula C9H14F3NO2
and a molecular weight of 225.21 g/mol. Its IUPAC name is 2-[cyclopropylmethyl(3,3,3-trifluoropropyl)amino]acetic acid.
Analyze 2-[cyclopropylmethyl(3,3,3-trifluoropropyl)amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[cyclopropylmethyl(3,3,3-trifluoropropyl)amino]acetic acid?
The IUPAC name of 2-[cyclopropylmethyl(3,3,3-trifluoropropyl)amino]acetic acid (CID 64566526) is 2-[cyclopropylmethyl(3,3,3-trifluoropropyl)amino]acetic acid.
What is the SMILES notation for 2-[cyclopropylmethyl(3,3,3-trifluoropropyl)amino]acetic acid?
The canonical SMILES for 2-[cyclopropylmethyl(3,3,3-trifluoropropyl)amino]acetic acid is O=C(O)CN(CCC(F)(F)F)CC1CC1.
What is the InChIKey of 2-[cyclopropylmethyl(3,3,3-trifluoropropyl)amino]acetic acid?
The InChIKey is BWTFDKKCPTZGJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F3NO2/c10-9(11,12)3-4-13(6-8(14)15)5-7-1-2-7/h7H,1-6H2,(H,14,15).
What are the key properties of 2-[cyclopropylmethyl(3,3,3-trifluoropropyl)amino]acetic acid?
2-[cyclopropylmethyl(3,3,3-trifluoropropyl)amino]acetic acid has a molecular weight of 225.21 g/mol, XLogP of 1.74, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyclopropylmethyl(3,3,3-trifluoropropyl)amino]acetic acid is sourced from PubChem (CID 64566526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).