2-[4-methyl-N-(3,3,3-trifluoropropyl)anilino]acetic acid

C12H14F3NO2 — CID 64566736

IUPAC2-[4-methyl-N-(3,3,3-trifluoropropyl)anilino]acetic acid
SMILESCc1ccc(N(CCC(F)(F)F)CC(=O)O)cc1
InChIInChI=1S/C12H14F3NO2/c1-9-2-4-10(5-3-9)16(8-11(17)18)7-6-12(13,14)15/h2-5H,6-8H2,1H3,(H,17,18)
InChIKeyRZFUKLFKJUBBCB-UHFFFAOYSA-N
MW261.24 g/mol
LogP2.84
Rot. Bonds5

About 2-[4-methyl-N-(3,3,3-trifluoropropyl)anilino]acetic acid

2-[4-methyl-N-(3,3,3-trifluoropropyl)anilino]acetic acid (PubChem CID 64566736) has the molecular formula C12H14F3NO2 and a molecular weight of 261.24 g/mol. Its IUPAC name is 2-[4-methyl-N-(3,3,3-trifluoropropyl)anilino]acetic acid.

Molecular Properties

Compound Name2-[4-methyl-N-(3,3,3-trifluoropropyl)anilino]acetic acid
PubChem CID64566736
Molecular FormulaC12H14F3NO2
Molecular Weight261.24 g/mol
Exact Mass261.10
IUPAC Name2-[4-methyl-N-(3,3,3-trifluoropropyl)anilino]acetic acid
SMILESCc1ccc(N(CCC(F)(F)F)CC(=O)O)cc1
InChIInChI=1S/C12H14F3NO2/c1-9-2-4-10(5-3-9)16(8-11(17)18)7-6-12(13,14)15/h2-5H,6-8H2,1H3,(H,17,18)
InChIKeyRZFUKLFKJUBBCB-UHFFFAOYSA-N
XLogP2.84
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.24
LogP ≤ 52.84
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}

Analyze 2-[4-methyl-N-(3,3,3-trifluoropropyl)anilino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-methyl-N-(3,3,3-trifluoropropyl)anilino]acetic acid?
The IUPAC name of 2-[4-methyl-N-(3,3,3-trifluoropropyl)anilino]acetic acid (CID 64566736) is 2-[4-methyl-N-(3,3,3-trifluoropropyl)anilino]acetic acid.
What is the SMILES notation for 2-[4-methyl-N-(3,3,3-trifluoropropyl)anilino]acetic acid?
The canonical SMILES for 2-[4-methyl-N-(3,3,3-trifluoropropyl)anilino]acetic acid is Cc1ccc(N(CCC(F)(F)F)CC(=O)O)cc1.
What is the InChIKey of 2-[4-methyl-N-(3,3,3-trifluoropropyl)anilino]acetic acid?
The InChIKey is RZFUKLFKJUBBCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F3NO2/c1-9-2-4-10(5-3-9)16(8-11(17)18)7-6-12(13,14)15/h2-5H,6-8H2,1H3,(H,17,18).
What are the key properties of 2-[4-methyl-N-(3,3,3-trifluoropropyl)anilino]acetic acid?
2-[4-methyl-N-(3,3,3-trifluoropropyl)anilino]acetic acid has a molecular weight of 261.24 g/mol, XLogP of 2.84, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-methyl-N-(3,3,3-trifluoropropyl)anilino]acetic acid is sourced from PubChem (CID 64566736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).