C10H16F3NO — CID 64566988
3-(3,3,3-trifluoropropyl)-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 64566988) has the molecular formula C10H16F3NO and a molecular weight of 223.24 g/mol. Its IUPAC name is 3-(3,3,3-trifluoropropyl)-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-(3,3,3-trifluoropropyl)-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 64566988 |
| Molecular Formula | C10H16F3NO |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 3-(3,3,3-trifluoropropyl)-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | OC1(CCC(F)(F)F)CC2CCC(C1)N2 |
| InChI | InChI=1S/C10H16F3NO/c11-10(12,13)4-3-9(15)5-7-1-2-8(6-9)14-7/h7-8,14-15H,1-6H2 |
| InChIKey | PKUCAQMLMRKBKY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |