About 3-(3,3,3-trifluoropropylamino)bicyclo[2.2.1]heptane-2-carboxylic acid
3-(3,3,3-trifluoropropylamino)bicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 64567143) has the molecular formula C11H16F3NO2
and a molecular weight of 251.25 g/mol. Its IUPAC name is 3-(3,3,3-trifluoropropylamino)bicyclo[2.2.1]heptane-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-(3,3,3-trifluoropropylamino)bicyclo[2.2.1]heptane-2-carboxylic acid |
| PubChem CID | 64567143 |
| Molecular Formula | C11H16F3NO2 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 3-(3,3,3-trifluoropropylamino)bicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | O=C(O)C1C2CCC(C2)C1NCCC(F)(F)F |
| InChI | InChI=1S/C11H16F3NO2/c12-11(13,14)3-4-15-9-7-2-1-6(5-7)8(9)10(16)17/h6-9,15H,1-5H2,(H,16,17) |
| InChIKey | VEXWWSULPWSCCJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3,3,3-trifluoropropylamino)bicyclo[2.2.1]heptane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3,3-trifluoropropylamino)bicyclo[2.2.1]heptane-2-carboxylic acid?
The IUPAC name of 3-(3,3,3-trifluoropropylamino)bicyclo[2.2.1]heptane-2-carboxylic acid (CID 64567143) is 3-(3,3,3-trifluoropropylamino)bicyclo[2.2.1]heptane-2-carboxylic acid.
What is the SMILES notation for 3-(3,3,3-trifluoropropylamino)bicyclo[2.2.1]heptane-2-carboxylic acid?
The canonical SMILES for 3-(3,3,3-trifluoropropylamino)bicyclo[2.2.1]heptane-2-carboxylic acid is O=C(O)C1C2CCC(C2)C1NCCC(F)(F)F.
What is the InChIKey of 3-(3,3,3-trifluoropropylamino)bicyclo[2.2.1]heptane-2-carboxylic acid?
The InChIKey is VEXWWSULPWSCCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F3NO2/c12-11(13,14)3-4-15-9-7-2-1-6(5-7)8(9)10(16)17/h6-9,15H,1-5H2,(H,16,17).
What are the key properties of 3-(3,3,3-trifluoropropylamino)bicyclo[2.2.1]heptane-2-carboxylic acid?
3-(3,3,3-trifluoropropylamino)bicyclo[2.2.1]heptane-2-carboxylic acid has a molecular weight of 251.25 g/mol, XLogP of 2.03, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3,3-trifluoropropylamino)bicyclo[2.2.1]heptane-2-carboxylic acid is sourced from PubChem (CID 64567143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).