About 3-amino-N-(2,3-dimethylbutyl)-1-propylpyrazole-4-sulfonamide
3-amino-N-(2,3-dimethylbutyl)-1-propylpyrazole-4-sulfonamide (PubChem CID 64570397) has the molecular formula C12H24N4O2S
and a molecular weight of 288.42 g/mol. Its IUPAC name is 3-amino-N-(2,3-dimethylbutyl)-1-propylpyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | 3-amino-N-(2,3-dimethylbutyl)-1-propylpyrazole-4-sulfonamide |
| PubChem CID | 64570397 |
| Molecular Formula | C12H24N4O2S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 3-amino-N-(2,3-dimethylbutyl)-1-propylpyrazole-4-sulfonamide |
| SMILES | CCCn1cc(S(=O)(=O)NCC(C)C(C)C)c(N)n1 |
| InChI | InChI=1S/C12H24N4O2S/c1-5-6-16-8-11(12(13)15-16)19(17,18)14-7-10(4)9(2)3/h8-10,14H,5-7H2,1-4H3,(H2,13,15) |
| InChIKey | QFSSLINCBBJMAU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-N-(2,3-dimethylbutyl)-1-propylpyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-(2,3-dimethylbutyl)-1-propylpyrazole-4-sulfonamide?
The IUPAC name of 3-amino-N-(2,3-dimethylbutyl)-1-propylpyrazole-4-sulfonamide (CID 64570397) is 3-amino-N-(2,3-dimethylbutyl)-1-propylpyrazole-4-sulfonamide.
What is the SMILES notation for 3-amino-N-(2,3-dimethylbutyl)-1-propylpyrazole-4-sulfonamide?
The canonical SMILES for 3-amino-N-(2,3-dimethylbutyl)-1-propylpyrazole-4-sulfonamide is CCCn1cc(S(=O)(=O)NCC(C)C(C)C)c(N)n1.
What is the InChIKey of 3-amino-N-(2,3-dimethylbutyl)-1-propylpyrazole-4-sulfonamide?
The InChIKey is QFSSLINCBBJMAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N4O2S/c1-5-6-16-8-11(12(13)15-16)19(17,18)14-7-10(4)9(2)3/h8-10,14H,5-7H2,1-4H3,(H2,13,15).
What are the key properties of 3-amino-N-(2,3-dimethylbutyl)-1-propylpyrazole-4-sulfonamide?
3-amino-N-(2,3-dimethylbutyl)-1-propylpyrazole-4-sulfonamide has a molecular weight of 288.42 g/mol, XLogP of 1.45, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-(2,3-dimethylbutyl)-1-propylpyrazole-4-sulfonamide is sourced from PubChem (CID 64570397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).