About 2-N-(2,3-dimethylbutyl)pyridine-2,5-diamine
2-N-(2,3-dimethylbutyl)pyridine-2,5-diamine (PubChem CID 64570407) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-N-(2,3-dimethylbutyl)pyridine-2,5-diamine.
Molecular Properties
| Compound Name | 2-N-(2,3-dimethylbutyl)pyridine-2,5-diamine |
| PubChem CID | 64570407 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 2-N-(2,3-dimethylbutyl)pyridine-2,5-diamine |
| SMILES | CC(C)C(C)CNc1ccc(N)cn1 |
| InChI | InChI=1S/C11H19N3/c1-8(2)9(3)6-13-11-5-4-10(12)7-14-11/h4-5,7-9H,6,12H2,1-3H3,(H,13,14) |
| InChIKey | FNYPKDHWKHLQIB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N-(2,3-dimethylbutyl)pyridine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(2,3-dimethylbutyl)pyridine-2,5-diamine?
The IUPAC name of 2-N-(2,3-dimethylbutyl)pyridine-2,5-diamine (CID 64570407) is 2-N-(2,3-dimethylbutyl)pyridine-2,5-diamine.
What is the SMILES notation for 2-N-(2,3-dimethylbutyl)pyridine-2,5-diamine?
The canonical SMILES for 2-N-(2,3-dimethylbutyl)pyridine-2,5-diamine is CC(C)C(C)CNc1ccc(N)cn1.
What is the InChIKey of 2-N-(2,3-dimethylbutyl)pyridine-2,5-diamine?
The InChIKey is FNYPKDHWKHLQIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3/c1-8(2)9(3)6-13-11-5-4-10(12)7-14-11/h4-5,7-9H,6,12H2,1-3H3,(H,13,14).
What are the key properties of 2-N-(2,3-dimethylbutyl)pyridine-2,5-diamine?
2-N-(2,3-dimethylbutyl)pyridine-2,5-diamine has a molecular weight of 193.29 g/mol, XLogP of 2.37, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(2,3-dimethylbutyl)pyridine-2,5-diamine is sourced from PubChem (CID 64570407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).