About azepane-2-carbohydrazide
azepane-2-carbohydrazide (PubChem CID 64570757) has the molecular formula C7H15N3O
and a molecular weight of 157.22 g/mol. Its IUPAC name is azepane-2-carbohydrazide.
Molecular Properties
| Compound Name | azepane-2-carbohydrazide |
| PubChem CID | 64570757 |
| Molecular Formula | C7H15N3O |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.12 |
| IUPAC Name | azepane-2-carbohydrazide |
| SMILES | NNC(=O)C1CCCCCN1 |
| InChI | InChI=1S/C7H15N3O/c8-10-7(11)6-4-2-1-3-5-9-6/h6,9H,1-5,8H2,(H,10,11) |
| InChIKey | IIEMHEMZLVMHBG-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azepane-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azepane-2-carbohydrazide?
The IUPAC name of azepane-2-carbohydrazide (CID 64570757) is azepane-2-carbohydrazide.
What is the SMILES notation for azepane-2-carbohydrazide?
The canonical SMILES for azepane-2-carbohydrazide is NNC(=O)C1CCCCCN1.
What is the InChIKey of azepane-2-carbohydrazide?
The InChIKey is IIEMHEMZLVMHBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3O/c8-10-7(11)6-4-2-1-3-5-9-6/h6,9H,1-5,8H2,(H,10,11).
What are the key properties of azepane-2-carbohydrazide?
azepane-2-carbohydrazide has a molecular weight of 157.22 g/mol, XLogP of -0.49, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azepane-2-carbohydrazide is sourced from PubChem (CID 64570757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).