C10H20N4S — CID 64571757
3-amino-4-(2,4,4-trimethylpentan-2-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 64571757) has the molecular formula C10H20N4S and a molecular weight of 228.36 g/mol. Its IUPAC name is 3-amino-4-(2,4,4-trimethylpentan-2-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-amino-4-(2,4,4-trimethylpentan-2-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 64571757 |
| Molecular Formula | C10H20N4S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 3-amino-4-(2,4,4-trimethylpentan-2-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | CC(C)(C)CC(C)(C)n1c(N)n[nH]c1=S |
| InChI | InChI=1S/C10H20N4S/c1-9(2,3)6-10(4,5)14-7(11)12-13-8(14)15/h6H2,1-5H3,(H2,11,12)(H,13,15) |
| InChIKey | XPUOKESTFODKKG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 59.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|