C7H12N4O2S2 — CID 64573457
3-amino-4-(1,1-dioxothian-3-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 64573457) has the molecular formula C7H12N4O2S2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 3-amino-4-(1,1-dioxothian-3-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-amino-4-(1,1-dioxothian-3-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 64573457 |
| Molecular Formula | C7H12N4O2S2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 3-amino-4-(1,1-dioxothian-3-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | Nc1n[nH]c(=S)n1C1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H12N4O2S2/c8-6-9-10-7(14)11(6)5-2-1-3-15(12,13)4-5/h5H,1-4H2,(H2,8,9)(H,10,14) |
| InChIKey | IWMGTFZOBPYVDL-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 93.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|