C12H19N5O2S — CID 64573919
2-[[5-amino-4-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid (PubChem CID 64573919) has the molecular formula C12H19N5O2S and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-[[5-amino-4-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-amino-4-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 64573919 |
| Molecular Formula | C12H19N5O2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-[[5-amino-4-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| SMILES | Nc1nnc(SCC(=O)O)n1C1CCN2CCCCC12 |
| InChI | InChI=1S/C12H19N5O2S/c13-11-14-15-12(20-7-10(18)19)17(11)9-4-6-16-5-2-1-3-8(9)16/h8-9H,1-7H2,(H2,13,14)(H,18,19) |
| InChIKey | AVILSEQMJMWKER-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |